C31H49NO8 — CID 163964783
(3S,5S)-5-[(1S,3S)-3-[4-methoxy-3-(3-methoxypropoxy)benzoyl]-4-methyl-1-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]pentyl]-3-propan-2-yloxolan-2-one (PubChem CID 163964783) has the molecular formula C31H49NO8 and a molecular weight of 563.73 g/mol. Its IUPAC name is (3S,5S)-5-[(1S,3S)-3-[4-methoxy-3-(3-methoxypropoxy)benzoyl]-4-methyl-1-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]pentyl]-3-propan-2-yloxolan-2-one.
| Compound Name | (3S,5S)-5-[(1S,3S)-3-[4-methoxy-3-(3-methoxypropoxy)benzoyl]-4-methyl-1-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]pentyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 163964783 |
| Molecular Formula | C31H49NO8 |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | (3S,5S)-5-[(1S,3S)-3-[4-methoxy-3-(3-methoxypropoxy)benzoyl]-4-methyl-1-[[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]amino]pentyl]-3-propan-2-yloxolan-2-one |
| SMILES | COCCCOc1cc(C(=O)[C@@H](C[C@H](NC2OC2OC(C)(C)C)[C@@H]2C[C@@H](C(C)C)C(=O)O2)C(C)C)ccc1OC |
| InChI | InChI=1S/C31H49NO8/c1-18(2)21(27(33)20-11-12-24(36-9)26(15-20)37-14-10-13-35-8)16-23(25-17-22(19(3)4)29(34)38-25)32-28-30(39-28)40-31(5,6)7/h11-12,15,18-19,21-23,25,28,30,32H,10,13-14,16-17H2,1-9H3/t21-,22-,23-,25-,28?,30?/m0/s1 |
| InChIKey | SKSIXPQNTVVDFI-NWGRSXPPSA-N |
| XLogP | 5.00 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|