C8H16N2O2 — CID 163964807
4,4,5,5-tetramethyl-2-(methylideneamino)-1,3-dioxolan-2-amine (PubChem CID 163964807) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(methylideneamino)-1,3-dioxolan-2-amine.
| Compound Name | 4,4,5,5-tetramethyl-2-(methylideneamino)-1,3-dioxolan-2-amine |
|---|---|
| PubChem CID | 163964807 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(methylideneamino)-1,3-dioxolan-2-amine |
| SMILES | C=NC1(N)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C8H16N2O2/c1-6(2)7(3,4)12-8(9,10-5)11-6/h5,9H2,1-4H3 |
| InChIKey | SKTAFDIVMQAMIY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|