C8H14N2O — CID 163965655
(1E,3R,4R)-4,5-diamino-3-ethenylhexa-1,5-dien-1-ol (PubChem CID 163965655) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1E,3R,4R)-4,5-diamino-3-ethenylhexa-1,5-dien-1-ol.
| Compound Name | (1E,3R,4R)-4,5-diamino-3-ethenylhexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 163965655 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1E,3R,4R)-4,5-diamino-3-ethenylhexa-1,5-dien-1-ol |
| SMILES | C=C[C@H](/C=C/O)[C@@H](N)C(=C)N |
| InChI | InChI=1S/C8H14N2O/c1-3-7(4-5-11)8(10)6(2)9/h3-5,7-8,11H,1-2,9-10H2/b5-4+/t7-,8+/m1/s1 |
| InChIKey | SLMMQDDPLYCLFU-VWFQECGMSA-N |
| XLogP | 0.66 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|