C18H14N2O7S2 — CID 163965938
2-phenyl-1-[5-(2-phenyl-1-sulfoethenyl)-1,3,4-oxadiazol-2-yl]ethenesulfonic acid (PubChem CID 163965938) has the molecular formula C18H14N2O7S2 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-phenyl-1-[5-(2-phenyl-1-sulfoethenyl)-1,3,4-oxadiazol-2-yl]ethenesulfonic acid.
| Compound Name | 2-phenyl-1-[5-(2-phenyl-1-sulfoethenyl)-1,3,4-oxadiazol-2-yl]ethenesulfonic acid |
|---|---|
| PubChem CID | 163965938 |
| Molecular Formula | C18H14N2O7S2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 2-phenyl-1-[5-(2-phenyl-1-sulfoethenyl)-1,3,4-oxadiazol-2-yl]ethenesulfonic acid |
| SMILES | O=S(=O)(O)C(=Cc1ccccc1)c1nnc(C(=Cc2ccccc2)S(=O)(=O)O)o1 |
| InChI | InChI=1S/C18H14N2O7S2/c21-28(22,23)15(11-13-7-3-1-4-8-13)17-19-20-18(27-17)16(29(24,25)26)12-14-9-5-2-6-10-14/h1-12H,(H,21,22,23)(H,24,25,26) |
| InChIKey | SLTMWBIBEGERAS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|