C19H34N2O3 — CID 163966940
(5R)-7-[ethyl(hydroxy)amino]-5-[[(3R)-3-ethyl-6-methylcyclohexa-1,5-dien-1-yl]methyl]-5-hydroxyheptanamide (PubChem CID 163966940) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is (5R)-7-[ethyl(hydroxy)amino]-5-[[(3R)-3-ethyl-6-methylcyclohexa-1,5-dien-1-yl]methyl]-5-hydroxyheptanamide.
| Compound Name | (5R)-7-[ethyl(hydroxy)amino]-5-[[(3R)-3-ethyl-6-methylcyclohexa-1,5-dien-1-yl]methyl]-5-hydroxyheptanamide |
|---|---|
| PubChem CID | 163966940 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (5R)-7-[ethyl(hydroxy)amino]-5-[[(3R)-3-ethyl-6-methylcyclohexa-1,5-dien-1-yl]methyl]-5-hydroxyheptanamide |
| SMILES | CC[C@H]1C=C(C[C@](O)(CCCC(N)=O)CCN(O)CC)C(C)=CC1 |
| InChI | InChI=1S/C19H34N2O3/c1-4-16-9-8-15(3)17(13-16)14-19(23,10-6-7-18(20)22)11-12-21(24)5-2/h8,13,16,23-24H,4-7,9-12,14H2,1-3H3,(H2,20,22)/t16-,19+/m1/s1 |
| InChIKey | SMPIKUAIQYLVEB-APWZRJJASA-N |
| XLogP | 3.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|