C13H23F3N2 — CID 163967516
N'-ethyl-N-methyl-N'-[(3Z)-7,7,7-trifluoro-6-methylhepta-1,3-dien-2-yl]ethane-1,2-diamine (PubChem CID 163967516) has the molecular formula C13H23F3N2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-[(3Z)-7,7,7-trifluoro-6-methylhepta-1,3-dien-2-yl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N-methyl-N'-[(3Z)-7,7,7-trifluoro-6-methylhepta-1,3-dien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 163967516 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N'-ethyl-N-methyl-N'-[(3Z)-7,7,7-trifluoro-6-methylhepta-1,3-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(/C=C\CC(C)C(F)(F)F)N(CC)CCNC |
| InChI | InChI=1S/C13H23F3N2/c1-5-18(10-9-17-4)12(3)8-6-7-11(2)13(14,15)16/h6,8,11,17H,3,5,7,9-10H2,1-2,4H3/b8-6- |
| InChIKey | SNBYAICCNIMJSK-VURMDHGXSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|