C14H20N5O2+ — CID 163967599
[1-amino-3-[[4-[[(E)-but-2-enoyl]amino]-1-methylpyrrole-2-carbonyl]amino]propylidene]-methylideneazanium (PubChem CID 163967599) has the molecular formula C14H20N5O2+ and a molecular weight of 290.35 g/mol. Its IUPAC name is [1-amino-3-[[4-[[(E)-but-2-enoyl]amino]-1-methylpyrrole-2-carbonyl]amino]propylidene]-methylideneazanium.
| Compound Name | [1-amino-3-[[4-[[(E)-but-2-enoyl]amino]-1-methylpyrrole-2-carbonyl]amino]propylidene]-methylideneazanium |
|---|---|
| PubChem CID | 163967599 |
| Molecular Formula | C14H20N5O2+ |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [1-amino-3-[[4-[[(E)-but-2-enoyl]amino]-1-methylpyrrole-2-carbonyl]amino]propylidene]-methylideneazanium |
| SMILES | C=[N+]=C(N)CCNC(=O)c1cc(NC(=O)/C=C/C)cn1C |
| InChI | InChI=1S/C14H19N5O2/c1-4-5-13(20)18-10-8-11(19(3)9-10)14(21)17-7-6-12(15)16-2/h4-5,8-9,15H,2,6-7H2,1,3H3,(H2,17,18,20,21)/p+1/b5-4+ |
| InChIKey | QDAQQFYYWFRZNQ-SNAWJCMRSA-O |
| XLogP | -0.22 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|