C13H23N3O4 — CID 163968135
4-[[1-(2-ethoxyethyl)triazol-4-yl]methoxy]-2,2-dimethylbutanoic acid (PubChem CID 163968135) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-[[1-(2-ethoxyethyl)triazol-4-yl]methoxy]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[1-(2-ethoxyethyl)triazol-4-yl]methoxy]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 163968135 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-[[1-(2-ethoxyethyl)triazol-4-yl]methoxy]-2,2-dimethylbutanoic acid |
| SMILES | CCOCCn1cc(COCCC(C)(C)C(=O)O)nn1 |
| InChI | InChI=1S/C13H23N3O4/c1-4-19-8-6-16-9-11(14-15-16)10-20-7-5-13(2,3)12(17)18/h9H,4-8,10H2,1-3H3,(H,17,18) |
| InChIKey | SNQGRYFUPUKVMR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|