About 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide
1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide (PubChem CID 163968178) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide.
Molecular Properties
| Compound Name | 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide |
| PubChem CID | 163968178 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide |
| SMILES | [H]N=S1(=O)CCCc2cc(C)ncc21 |
| InChI | InChI=1S/C9H12N2OS/c1-7-5-8-3-2-4-13(10,12)9(8)6-11-7/h5-6,10H,2-4H2,1H3 |
| InChIKey | SNRBBPHZDWZWHI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide?
The IUPAC name of 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide (CID 163968178) is 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide.
What is the SMILES notation for 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide?
The canonical SMILES for 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide is [H]N=S1(=O)CCCc2cc(C)ncc21.
What is the InChIKey of 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide?
The InChIKey is SNRBBPHZDWZWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-7-5-8-3-2-4-13(10,12)9(8)6-11-7/h5-6,10H,2-4H2,1H3.
What are the key properties of 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide?
1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide has a molecular weight of 196.28 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imino-6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1-oxide is sourced from PubChem (CID 163968178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).