C38H38O4 — CID 163968348
[(11R)-8-methyl-10-(2,4,6-trimethylbenzoyl)oxy-9-tetracyclo[9.6.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] 2,4,6-trimethylbenzoate (PubChem CID 163968348) has the molecular formula C38H38O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is [(11R)-8-methyl-10-(2,4,6-trimethylbenzoyl)oxy-9-tetracyclo[9.6.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] 2,4,6-trimethylbenzoate.
| Compound Name | [(11R)-8-methyl-10-(2,4,6-trimethylbenzoyl)oxy-9-tetracyclo[9.6.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 163968348 |
| Molecular Formula | C38H38O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | [(11R)-8-methyl-10-(2,4,6-trimethylbenzoyl)oxy-9-tetracyclo[9.6.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC2C(C)c3ccccc3C3c4ccccc4[C@@H]3C2OC(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C38H38O4/c1-20-16-22(3)31(23(4)17-20)37(39)41-35-26(7)27-12-8-9-13-28(27)33-29-14-10-11-15-30(29)34(33)36(35)42-38(40)32-24(5)18-21(2)19-25(32)6/h8-19,26,33-36H,1-7H3/t26?,33?,34-,35?,36?/m0/s1 |
| InChIKey | SNUQCVONTACTCW-AKPOCHNHSA-N |
| XLogP | 8.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |