C20H26BF2N3O4 — CID 163968878
6-[amino(methyl)amino]-2-(2,2-difluorocyclopropyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide (PubChem CID 163968878) has the molecular formula C20H26BF2N3O4 and a molecular weight of 421.25 g/mol. Its IUPAC name is 6-[amino(methyl)amino]-2-(2,2-difluorocyclopropyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide.
| Compound Name | 6-[amino(methyl)amino]-2-(2,2-difluorocyclopropyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 163968878 |
| Molecular Formula | C20H26BF2N3O4 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 6-[amino(methyl)amino]-2-(2,2-difluorocyclopropyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(C2CC2(F)F)oc2cc(N(C)N)c(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C20H26BF2N3O4/c1-18(2)19(3,4)30-21(29-18)12-7-10-14(8-13(12)26(6)24)28-16(11-9-20(11,22)23)15(10)17(27)25-5/h7-8,11H,9,24H2,1-6H3,(H,25,27) |
| InChIKey | SOFRLABRULKVCB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|