About 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide
9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide (PubChem CID 163969155) has the molecular formula C20H15IN3O-
and a molecular weight of 440.26 g/mol. Its IUPAC name is 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide.
Molecular Properties
| Compound Name | 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide |
| PubChem CID | 163969155 |
| Molecular Formula | C20H15IN3O- |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide |
| SMILES | Cc1ccc2c(oc3ncc4ccccc4c32)c1C1=CC=C[N-][NH2+]1.[I-] |
| InChI | InChI=1S/C20H15N3O.HI/c1-12-8-9-15-18-14-6-3-2-5-13(14)11-21-20(18)24-19(15)17(12)16-7-4-10-22-23-16;/h2-11H,23H2,1H3;1H/p-1 |
| InChIKey | PINWWCFDLHQZOP-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide?
The IUPAC name of 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide (CID 163969155) is 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide.
What is the SMILES notation for 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide?
The canonical SMILES for 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide is Cc1ccc2c(oc3ncc4ccccc4c32)c1C1=CC=C[N-][NH2+]1.[I-].
What is the InChIKey of 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide?
The InChIKey is PINWWCFDLHQZOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H15N3O.HI/c1-12-8-9-15-18-14-6-3-2-5-13(14)11-21-20(18)24-19(15)17(12)16-7-4-10-22-23-16;/h2-11H,23H2,1H3;1H/p-1.
What are the key properties of 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide?
9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide has a molecular weight of 440.26 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-8-(1H-pyridazin-1-ium-2-id-6-yl)-[1]benzofuro[2,3-c]isoquinoline iodide is sourced from PubChem (CID 163969155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).