About 7-methoxy-2-methyl-6H-1,3-diazonine
7-methoxy-2-methyl-6H-1,3-diazonine (PubChem CID 163969738) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 7-methoxy-2-methyl-6H-1,3-diazonine.
Molecular Properties
| Compound Name | 7-methoxy-2-methyl-6H-1,3-diazonine |
| PubChem CID | 163969738 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 7-methoxy-2-methyl-6H-1,3-diazonine |
| SMILES | COC1=C/C=N\C(C)=N/C=CC1 |
| InChI | InChI=1S/C9H12N2O/c1-8-10-6-3-4-9(12-2)5-7-11-8/h3,5-7H,4H2,1-2H3/b6-3?,9-5?,10-8-,11-7- |
| InChIKey | IZWXTQMNTKESDW-OEPHQJMHSA-N |
| XLogP | 1.92 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-2-methyl-6H-1,3-diazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2-methyl-6H-1,3-diazonine?
The IUPAC name of 7-methoxy-2-methyl-6H-1,3-diazonine (CID 163969738) is 7-methoxy-2-methyl-6H-1,3-diazonine.
What is the SMILES notation for 7-methoxy-2-methyl-6H-1,3-diazonine?
The canonical SMILES for 7-methoxy-2-methyl-6H-1,3-diazonine is COC1=C/C=N\C(C)=N/C=CC1.
What is the InChIKey of 7-methoxy-2-methyl-6H-1,3-diazonine?
The InChIKey is IZWXTQMNTKESDW-OEPHQJMHSA-N. The full InChI is InChI=1S/C9H12N2O/c1-8-10-6-3-4-9(12-2)5-7-11-8/h3,5-7H,4H2,1-2H3/b6-3?,9-5?,10-8-,11-7-.
What are the key properties of 7-methoxy-2-methyl-6H-1,3-diazonine?
7-methoxy-2-methyl-6H-1,3-diazonine has a molecular weight of 164.21 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2-methyl-6H-1,3-diazonine is sourced from PubChem (CID 163969738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).