About 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione
4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione (PubChem CID 163969816) has the molecular formula C7H9NS2
and a molecular weight of 171.29 g/mol. Its IUPAC name is 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione |
| PubChem CID | 163969816 |
| Molecular Formula | C7H9NS2 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione |
| SMILES | C=C(C)c1sc(=S)[nH]c1C |
| InChI | InChI=1S/C7H9NS2/c1-4(2)6-5(3)8-7(9)10-6/h1H2,2-3H3,(H,8,9) |
| InChIKey | SPAITDAXAJGZLR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione?
The IUPAC name of 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione (CID 163969816) is 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione?
The canonical SMILES for 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione is C=C(C)c1sc(=S)[nH]c1C.
What is the InChIKey of 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione?
The InChIKey is SPAITDAXAJGZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS2/c1-4(2)6-5(3)8-7(9)10-6/h1H2,2-3H3,(H,8,9).
What are the key properties of 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione?
4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione has a molecular weight of 171.29 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-prop-1-en-2-yl-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 163969816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).