About N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine
N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine (PubChem CID 163970100) has the molecular formula C16H12N6
and a molecular weight of 288.31 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine.
Molecular Properties
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine |
| PubChem CID | 163970100 |
| Molecular Formula | C16H12N6 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine |
| SMILES | c1cc(Nc2cnc3ccccc3n2)cc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C16H12N6/c1-2-7-14-13(6-1)17-9-15(21-14)20-12-5-3-4-11(8-12)16-18-10-19-22-16/h1-10H,(H,20,21)(H,18,19,22) |
| InChIKey | SPGMKJHJTLYIGC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine?
The IUPAC name of N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine (CID 163970100) is N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine.
What is the SMILES notation for N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine?
The canonical SMILES for N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine is c1cc(Nc2cnc3ccccc3n2)cc(-c2ncn[nH]2)c1.
What is the InChIKey of N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine?
The InChIKey is SPGMKJHJTLYIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6/c1-2-7-14-13(6-1)17-9-15(21-14)20-12-5-3-4-11(8-12)16-18-10-19-22-16/h1-10H,(H,20,21)(H,18,19,22).
What are the key properties of N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine?
N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine has a molecular weight of 288.31 g/mol, XLogP of 3.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinoxalin-2-amine is sourced from PubChem (CID 163970100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).