About (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde
(4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde (PubChem CID 163970699) has the molecular formula C19H16F2O5
and a molecular weight of 362.33 g/mol. Its IUPAC name is (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde.
Molecular Properties
| Compound Name | (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde |
| PubChem CID | 163970699 |
| Molecular Formula | C19H16F2O5 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde |
| SMILES | O=CC12OC(Oc3ccccc3Cc3ccccc3)C(O)C1(O)C2(F)F |
| InChI | InChI=1S/C19H16F2O5/c20-19(21)17(11-22)18(19,24)15(23)16(26-17)25-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9,11,15-16,23-24H,10H2 |
| InChIKey | SPTGFWHYQZOUDL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde?
The IUPAC name of (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde (CID 163970699) is (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde.
What is the SMILES notation for (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde?
The canonical SMILES for (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde is O=CC12OC(Oc3ccccc3Cc3ccccc3)C(O)C1(O)C2(F)F.
What is the InChIKey of (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde?
The InChIKey is SPTGFWHYQZOUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2O5/c20-19(21)17(11-22)18(19,24)15(23)16(26-17)25-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9,11,15-16,23-24H,10H2.
What are the key properties of (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde?
(4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde has a molecular weight of 362.33 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-(2-benzylphenoxy)-6,6-difluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexane-1-carbaldehyde is sourced from PubChem (CID 163970699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).