About (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile
(2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile (PubChem CID 163971341) has the molecular formula C11H9ClN2
and a molecular weight of 204.66 g/mol. Its IUPAC name is (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile |
| PubChem CID | 163971341 |
| Molecular Formula | C11H9ClN2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile |
| SMILES | N#C/C=C1/NCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H9ClN2/c12-9-2-1-8-4-6-14-11(3-5-13)10(8)7-9/h1-3,7,14H,4,6H2/b11-3+ |
| InChIKey | SQGAGMWXVROOLN-QDEBKDIKSA-N |
| XLogP | 2.35 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile?
The IUPAC name of (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile (CID 163971341) is (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile.
What is the SMILES notation for (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile?
The canonical SMILES for (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile is N#C/C=C1/NCCc2ccc(Cl)cc21.
What is the InChIKey of (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile?
The InChIKey is SQGAGMWXVROOLN-QDEBKDIKSA-N. The full InChI is InChI=1S/C11H9ClN2/c12-9-2-1-8-4-6-14-11(3-5-13)10(8)7-9/h1-3,7,14H,4,6H2/b11-3+.
What are the key properties of (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile?
(2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile has a molecular weight of 204.66 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(7-chloro-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile is sourced from PubChem (CID 163971341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).