C17H22BrN5O2S — CID 163971518
1-[2-[[(2-bromo-1,3-thiazol-4-yl)-hydroxymethyl]amino]phenyl]-4-(methylamino)piperidine-4-carboxamide (PubChem CID 163971518) has the molecular formula C17H22BrN5O2S and a molecular weight of 440.37 g/mol. Its IUPAC name is 1-[2-[[(2-bromo-1,3-thiazol-4-yl)-hydroxymethyl]amino]phenyl]-4-(methylamino)piperidine-4-carboxamide.
| Compound Name | 1-[2-[[(2-bromo-1,3-thiazol-4-yl)-hydroxymethyl]amino]phenyl]-4-(methylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 163971518 |
| Molecular Formula | C17H22BrN5O2S |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 1-[2-[[(2-bromo-1,3-thiazol-4-yl)-hydroxymethyl]amino]phenyl]-4-(methylamino)piperidine-4-carboxamide |
| SMILES | CNC1(C(N)=O)CCN(c2ccccc2NC(O)c2csc(Br)n2)CC1 |
| InChI | InChI=1S/C17H22BrN5O2S/c1-20-17(15(19)25)6-8-23(9-7-17)13-5-3-2-4-11(13)21-14(24)12-10-26-16(18)22-12/h2-5,10,14,20-21,24H,6-9H2,1H3,(H2,19,25) |
| InChIKey | SQJMBWPEVOUPJX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|