C10H20N4O3 — CID 163972321
N-(1-amino-1-oxopropan-2-yl)-2-(2-aminopropanoylamino)butanamide (PubChem CID 163972321) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(1-amino-1-oxopropan-2-yl)-2-(2-aminopropanoylamino)butanamide.
| Compound Name | N-(1-amino-1-oxopropan-2-yl)-2-(2-aminopropanoylamino)butanamide |
|---|---|
| PubChem CID | 163972321 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N-(1-amino-1-oxopropan-2-yl)-2-(2-aminopropanoylamino)butanamide |
| SMILES | CCC(NC(=O)C(C)N)C(=O)NC(C)C(N)=O |
| InChI | InChI=1S/C10H20N4O3/c1-4-7(14-9(16)5(2)11)10(17)13-6(3)8(12)15/h5-7H,4,11H2,1-3H3,(H2,12,15)(H,13,17)(H,14,16) |
| InChIKey | SRBMXBZCGGKTBI-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |