C22H24N3O3+ — CID 163972414
4-[5-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)-1-methylindol-2-yl]butyl-methylidyneazanium (PubChem CID 163972414) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-[5-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)-1-methylindol-2-yl]butyl-methylidyneazanium.
| Compound Name | 4-[5-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)-1-methylindol-2-yl]butyl-methylidyneazanium |
|---|---|
| PubChem CID | 163972414 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-[5-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)-1-methylindol-2-yl]butyl-methylidyneazanium |
| SMILES | C#[N+]CCCCc1cc2cc(-c3[nH]c(=O)c(C(=O)O)cc3CC)ccc2n1C |
| InChI | InChI=1S/C22H23N3O3/c1-4-14-13-18(22(27)28)21(26)24-20(14)15-8-9-19-16(11-15)12-17(25(19)3)7-5-6-10-23-2/h2,8-9,11-13H,4-7,10H2,1,3H3,(H-,24,26,27,28)/p+1 |
| InChIKey | WVGLWMVXORSCIS-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|