C11H18N2O5S — CID 163973889
3-methyl-2,5-dioxo-1-[2-[3-oxobutyl(sulfino)amino]ethyl]pyrrolidine (PubChem CID 163973889) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-methyl-2,5-dioxo-1-[2-[3-oxobutyl(sulfino)amino]ethyl]pyrrolidine.
| Compound Name | 3-methyl-2,5-dioxo-1-[2-[3-oxobutyl(sulfino)amino]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 163973889 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-methyl-2,5-dioxo-1-[2-[3-oxobutyl(sulfino)amino]ethyl]pyrrolidine |
| SMILES | CC(=O)CCN(CCN1C(=O)CC(C)C1=O)S(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-8-7-10(15)13(11(8)16)6-5-12(19(17)18)4-3-9(2)14/h8H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | QLFBLDSTMFGVSY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|