About 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol
3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol (PubChem CID 163975301) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol |
| PubChem CID | 163975301 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol |
| SMILES | CC(C)OC12OC(C)C(C)(O)CC1C2O |
| InChI | InChI=1S/C11H20O4/c1-6(2)14-11-8(9(11)12)5-10(4,13)7(3)15-11/h6-9,12-13H,5H2,1-4H3 |
| InChIKey | STOMAUAHWZXOJB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol?
The IUPAC name of 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol (CID 163975301) is 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol.
What is the SMILES notation for 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol?
The canonical SMILES for 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol is CC(C)OC12OC(C)C(C)(O)CC1C2O.
What is the InChIKey of 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol?
The InChIKey is STOMAUAHWZXOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-6(2)14-11-8(9(11)12)5-10(4,13)7(3)15-11/h6-9,12-13H,5H2,1-4H3.
What are the key properties of 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol?
3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol has a molecular weight of 216.28 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-propan-2-yloxy-2-oxabicyclo[4.1.0]heptane-4,7-diol is sourced from PubChem (CID 163975301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).