C46H42N4 — CID 163975401
(3R)-9-[4-(3,5-dimethylphenyl)quinazolin-2-yl]-3-(9-phenyl-4,4a,4b,7,8,8a-hexahydrocarbazol-2-yl)-3,4,5,6-tetrahydrocarbazole (PubChem CID 163975401) has the molecular formula C46H42N4 and a molecular weight of 650.87 g/mol. Its IUPAC name is (3R)-9-[4-(3,5-dimethylphenyl)quinazolin-2-yl]-3-(9-phenyl-4,4a,4b,7,8,8a-hexahydrocarbazol-2-yl)-3,4,5,6-tetrahydrocarbazole.
| Compound Name | (3R)-9-[4-(3,5-dimethylphenyl)quinazolin-2-yl]-3-(9-phenyl-4,4a,4b,7,8,8a-hexahydrocarbazol-2-yl)-3,4,5,6-tetrahydrocarbazole |
|---|---|
| PubChem CID | 163975401 |
| Molecular Formula | C46H42N4 |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | (3R)-9-[4-(3,5-dimethylphenyl)quinazolin-2-yl]-3-(9-phenyl-4,4a,4b,7,8,8a-hexahydrocarbazol-2-yl)-3,4,5,6-tetrahydrocarbazole |
| SMILES | Cc1cc(C)cc(-c2nc(-n3c4c(c5c3C=C[C@H](C3=CCC6C(=C3)N(c3ccccc3)C3CCC=CC63)C5)CCC=C4)nc3ccccc23)c1 |
| InChI | InChI=1S/C46H42N4/c1-29-24-30(2)26-33(25-29)45-38-16-6-9-17-40(38)47-46(48-45)50-42-19-11-8-15-36(42)39-27-31(21-23-43(39)50)32-20-22-37-35-14-7-10-18-41(35)49(44(37)28-32)34-12-4-3-5-13-34/h3-7,9,11-14,16-17,19-21,23-26,28,31,35,37,41H,8,10,15,18,22,27H2,1-2H3/t31-,35?,37?,41?/m0/s1 |
| InChIKey | STQWOESRVWGAON-WBWOOJEWSA-N |
| XLogP | 10.53 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|