C21H32N2O2 — CID 163976336
(2E,4Z)-6-[(2R,5S)-5-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]-3-methyl-1,3-oxazolidin-2-yl]-N,N-dimethylhepta-2,4,6-trien-3-amine (PubChem CID 163976336) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2E,4Z)-6-[(2R,5S)-5-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]-3-methyl-1,3-oxazolidin-2-yl]-N,N-dimethylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-[(2R,5S)-5-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]-3-methyl-1,3-oxazolidin-2-yl]-N,N-dimethylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 163976336 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (2E,4Z)-6-[(2R,5S)-5-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]-3-methyl-1,3-oxazolidin-2-yl]-N,N-dimethylhepta-2,4,6-trien-3-amine |
| SMILES | C=C/C(=C\C=C(/C)OC)[C@H]1CN(C)[C@@H](C(=C)/C=C\C(=C/C)N(C)C)O1 |
| InChI | InChI=1S/C21H32N2O2/c1-9-18(13-12-17(4)24-8)20-15-23(7)21(25-20)16(3)11-14-19(10-2)22(5)6/h9-14,20-21H,1,3,15H2,2,4-8H3/b14-11-,17-12+,18-13+,19-10+/t20-,21-/m1/s1 |
| InChIKey | SUMBBBOIBYQQGO-ZYQOXQHJSA-N |
| XLogP | 3.88 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|