C10H15F3O3S — CID 163977777
3,4,8-trimethyl-2-(trifluoromethyl)-6-oxa-7λ6-thiabicyclo[3.2.1]octane 7,7-dioxide (PubChem CID 163977777) has the molecular formula C10H15F3O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is 3,4,8-trimethyl-2-(trifluoromethyl)-6-oxa-7λ6-thiabicyclo[3.2.1]octane 7,7-dioxide.
| Compound Name | 3,4,8-trimethyl-2-(trifluoromethyl)-6-oxa-7λ6-thiabicyclo[3.2.1]octane 7,7-dioxide |
|---|---|
| PubChem CID | 163977777 |
| Molecular Formula | C10H15F3O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3,4,8-trimethyl-2-(trifluoromethyl)-6-oxa-7λ6-thiabicyclo[3.2.1]octane 7,7-dioxide |
| SMILES | CC1C(C)C(C(F)(F)F)C2C(C)C1OS2(=O)=O |
| InChI | InChI=1S/C10H15F3O3S/c1-4-5(2)8-6(3)9(17(14,15)16-8)7(4)10(11,12)13/h4-9H,1-3H3 |
| InChIKey | SVRRQGYIEMRZMP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|