C7H13NO5S — CID 163977896
(1R,2R,4S)-3-hydroxysulfanyl-5-methoxy-2-nitrosocyclohexane-1,4-diol (PubChem CID 163977896) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is (1R,2R,4S)-3-hydroxysulfanyl-5-methoxy-2-nitrosocyclohexane-1,4-diol.
| Compound Name | (1R,2R,4S)-3-hydroxysulfanyl-5-methoxy-2-nitrosocyclohexane-1,4-diol |
|---|---|
| PubChem CID | 163977896 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (1R,2R,4S)-3-hydroxysulfanyl-5-methoxy-2-nitrosocyclohexane-1,4-diol |
| SMILES | COC1C[C@@H](O)[C@@H](N=O)C(SO)[C@H]1O |
| InChI | InChI=1S/C7H13NO5S/c1-13-4-2-3(9)5(8-11)7(14-12)6(4)10/h3-7,9-10,12H,2H2,1H3/t3-,4?,5-,6+,7?/m1/s1 |
| InChIKey | SVTSCZBLPJHJQL-WMYZWQRYSA-N |
| XLogP | -0.16 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|