C10H11ClO — CID 163979066
7-chloro-3-methyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 163979066) has the molecular formula C10H11ClO and a molecular weight of 182.65 g/mol. Its IUPAC name is 7-chloro-3-methyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 7-chloro-3-methyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 163979066 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 7-chloro-3-methyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC1CCc2c(Cl)ccc(O)c21 |
| InChI | InChI=1S/C10H11ClO/c1-6-2-3-7-8(11)4-5-9(12)10(6)7/h4-6,12H,2-3H2,1H3 |
| InChIKey | SWTIXVUJOFELOV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |