About 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one
1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one (PubChem CID 163979151) has the molecular formula C21H28N2O4
and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one |
| PubChem CID | 163979151 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one |
| SMILES | CC1(O)C(=O)N(Cc2ccccc2)C=CC1CN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C21H28N2O4/c1-20(25)18(16-22-11-8-21(9-12-22)26-13-14-27-21)7-10-23(19(20)24)15-17-5-3-2-4-6-17/h2-7,10,18,25H,8-9,11-16H2,1H3 |
| InChIKey | SWVDSONMGYDIAE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one?
The IUPAC name of 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one (CID 163979151) is 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one.
What is the SMILES notation for 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one?
The canonical SMILES for 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one is CC1(O)C(=O)N(Cc2ccccc2)C=CC1CN1CCC2(CC1)OCCO2.
What is the InChIKey of 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one?
The InChIKey is SWVDSONMGYDIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4/c1-20(25)18(16-22-11-8-21(9-12-22)26-13-14-27-21)7-10-23(19(20)24)15-17-5-3-2-4-6-17/h2-7,10,18,25H,8-9,11-16H2,1H3.
What are the key properties of 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one?
1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one has a molecular weight of 372.47 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-hydroxy-3-methyl-4H-pyridin-2-one is sourced from PubChem (CID 163979151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).