C20H23FN6O — CID 163979611
[2-fluoro-6-[methyl-(methylideneamino)amino]phenyl]-[6-[(5-methylpyrazin-2-yl)amino]-2-azabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 163979611) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-fluoro-6-[methyl-(methylideneamino)amino]phenyl]-[6-[(5-methylpyrazin-2-yl)amino]-2-azabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [2-fluoro-6-[methyl-(methylideneamino)amino]phenyl]-[6-[(5-methylpyrazin-2-yl)amino]-2-azabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 163979611 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-fluoro-6-[methyl-(methylideneamino)amino]phenyl]-[6-[(5-methylpyrazin-2-yl)amino]-2-azabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | C=NN(C)c1cccc(F)c1C(=O)N1CC2CC(Nc3cnc(C)cn3)C1C2 |
| InChI | InChI=1S/C20H23FN6O/c1-12-9-24-18(10-23-12)25-15-7-13-8-17(15)27(11-13)20(28)19-14(21)5-4-6-16(19)26(3)22-2/h4-6,9-10,13,15,17H,2,7-8,11H2,1,3H3,(H,24,25) |
| InChIKey | SXFVKMQJRBESTA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|