C12H18S — CID 163979766
1,2,3-trimethyl-5-propylsulfanylbenzene (PubChem CID 163979766) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is 1,2,3-trimethyl-5-propylsulfanylbenzene.
| Compound Name | 1,2,3-trimethyl-5-propylsulfanylbenzene |
|---|---|
| PubChem CID | 163979766 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1,2,3-trimethyl-5-propylsulfanylbenzene |
| SMILES | CCCSc1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C12H18S/c1-5-6-13-12-7-9(2)11(4)10(3)8-12/h7-8H,5-6H2,1-4H3 |
| InChIKey | SXIZFKAFAARUSR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |