About ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol
ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol (PubChem CID 163979792) has the molecular formula C7H15NO2S
and a molecular weight of 177.27 g/mol. Its IUPAC name is ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol.
Molecular Properties
| Compound Name | ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol |
| PubChem CID | 163979792 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol |
| SMILES | CCOC(O)C1CSC(C)N1 |
| InChI | InChI=1S/C7H15NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h5-9H,3-4H2,1-2H3 |
| InChIKey | SXJOUAMORZJTLH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol?
The IUPAC name of ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol (CID 163979792) is ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol.
What is the SMILES notation for ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol?
The canonical SMILES for ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol is CCOC(O)C1CSC(C)N1.
What is the InChIKey of ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol?
The InChIKey is SXJOUAMORZJTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h5-9H,3-4H2,1-2H3.
What are the key properties of ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol?
ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol has a molecular weight of 177.27 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-(2-methyl-1,3-thiazolidin-4-yl)methanol is sourced from PubChem (CID 163979792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).