About 2-methyl-2-phenyloxirane
2-methyl-2-phenyloxirane (PubChem CID 16398) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-methyl-2-phenyloxirane.
Molecular Properties
| Compound Name | 2-methyl-2-phenyloxirane |
| PubChem CID | 16398 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2-methyl-2-phenyloxirane |
| SMILES | CC1(c2ccccc2)CO1 |
| InChI | InChI=1S/C9H10O/c1-9(7-10-9)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | MRXPNWXSFCODDY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenyloxirane?
The IUPAC name of 2-methyl-2-phenyloxirane (CID 16398) is 2-methyl-2-phenyloxirane.
What is the SMILES notation for 2-methyl-2-phenyloxirane?
The canonical SMILES for 2-methyl-2-phenyloxirane is CC1(c2ccccc2)CO1.
What is the InChIKey of 2-methyl-2-phenyloxirane?
The InChIKey is MRXPNWXSFCODDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-9(7-10-9)8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of 2-methyl-2-phenyloxirane?
2-methyl-2-phenyloxirane has a molecular weight of 134.18 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenyloxirane is sourced from PubChem (CID 16398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).