C14H23BF2O2 — CID 163980399
2-(4,4-difluorocyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 163980399) has the molecular formula C14H23BF2O2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | 2-(4,4-difluorocyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163980399 |
| Molecular Formula | C14H23BF2O2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-(4,4-difluorocyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)C1(C)OB(C2=CCC(F)(F)CC2)OC1(C)C |
| InChI | InChI=1S/C14H23BF2O2/c1-10(2)13(5)12(3,4)18-15(19-13)11-6-8-14(16,17)9-7-11/h6,10H,7-9H2,1-5H3 |
| InChIKey | SXWDJPXWHRMXRD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|