C13H27NO — CID 163982710
6-(ethylamino)-3,3,5,5-tetramethyl-2-methylidenehexan-1-ol (PubChem CID 163982710) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 6-(ethylamino)-3,3,5,5-tetramethyl-2-methylidenehexan-1-ol.
| Compound Name | 6-(ethylamino)-3,3,5,5-tetramethyl-2-methylidenehexan-1-ol |
|---|---|
| PubChem CID | 163982710 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 6-(ethylamino)-3,3,5,5-tetramethyl-2-methylidenehexan-1-ol |
| SMILES | C=C(CO)C(C)(C)CC(C)(C)CNCC |
| InChI | InChI=1S/C13H27NO/c1-7-14-10-12(3,4)9-13(5,6)11(2)8-15/h14-15H,2,7-10H2,1,3-6H3 |
| InChIKey | SZUKVUUBCTYMPV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|