C9H13N2O3S2+ — CID 163982997
5-[2-(2-methyl-2-methyl-1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione (PubChem CID 163982997) has the molecular formula C9H13N2O3S2+ and a molecular weight of 261.35 g/mol. Its IUPAC name is 5-[2-(2-methyl-2-methyl-1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione.
| Compound Name | 5-[2-(2-methyl-2-methyl-1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione |
|---|---|
| PubChem CID | 163982997 |
| Molecular Formula | C9H13N2O3S2+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 5-[2-(2-methyl-2-methyl-1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione |
| SMILES | [CH2+]C1(C)OCC(CCOc2nc(=S)[nH]s2)O1 |
| InChI | InChI=1S/C9H12N2O3S2/c1-9(2)13-5-6(14-9)3-4-12-8-10-7(15)11-16-8/h6H,1,3-5H2,2H3/p+1 |
| InChIKey | SZZSQRQQNQSIEY-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|