C14H27F2NO — CID 163983074
(E,2R,3S,6S,8R)-2,3-difluoro-6,8-dimethyl-9-propoxynon-4-en-1-amine (PubChem CID 163983074) has the molecular formula C14H27F2NO and a molecular weight of 263.37 g/mol. Its IUPAC name is (E,2R,3S,6S,8R)-2,3-difluoro-6,8-dimethyl-9-propoxynon-4-en-1-amine.
| Compound Name | (E,2R,3S,6S,8R)-2,3-difluoro-6,8-dimethyl-9-propoxynon-4-en-1-amine |
|---|---|
| PubChem CID | 163983074 |
| Molecular Formula | C14H27F2NO |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | (E,2R,3S,6S,8R)-2,3-difluoro-6,8-dimethyl-9-propoxynon-4-en-1-amine |
| SMILES | CCCOC[C@H](C)C[C@H](C)/C=C/[C@H](F)[C@H](F)CN |
| InChI | InChI=1S/C14H27F2NO/c1-4-7-18-10-12(3)8-11(2)5-6-13(15)14(16)9-17/h5-6,11-14H,4,7-10,17H2,1-3H3/b6-5+/t11-,12-,13+,14-/m1/s1 |
| InChIKey | TTXPBCDNGFVGEO-TYGOHYGSSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|