C6H9N3O3S — CID 163984584
1-[(1R)-1-methylsulfanylethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 163984584) has the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. Its IUPAC name is 1-[(1R)-1-methylsulfanylethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(1R)-1-methylsulfanylethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163984584 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1-[(1R)-1-methylsulfanylethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CS[C@H](C)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H9N3O3S/c1-3(13-2)9-5(11)7-4(10)8-6(9)12/h3H,1-2H3,(H2,7,8,10,11,12)/t3-/m1/s1 |
| InChIKey | TVDIXPGTVGZDAE-GSVOUGTGSA-N |
| XLogP | -0.89 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |