C16H16F3N3OPS+ — CID 163985176
1H-benzimidazol-2-yl-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-phosphanylsulfanium (PubChem CID 163985176) has the molecular formula C16H16F3N3OPS+ and a molecular weight of 386.36 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-phosphanylsulfanium.
| Compound Name | 1H-benzimidazol-2-yl-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-phosphanylsulfanium |
|---|---|
| PubChem CID | 163985176 |
| Molecular Formula | C16H16F3N3OPS+ |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 1H-benzimidazol-2-yl-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-phosphanylsulfanium |
| SMILES | Cc1c(OCC(F)(F)F)ccnc1C[S+](P)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H16F3N3OPS/c1-10-13(20-7-6-14(10)23-9-16(17,18)19)8-25(24)15-21-11-4-2-3-5-12(11)22-15/h2-7H,8-9,24H2,1H3,(H,21,22)/q+1 |
| InChIKey | TVQXOUMSMYLTQX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|