C28H32ClN3O2 — CID 163985201
7-[5-[1-(3-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-6-yl]pentoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 163985201) has the molecular formula C28H32ClN3O2 and a molecular weight of 478.04 g/mol. Its IUPAC name is 7-[5-[1-(3-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-6-yl]pentoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[5-[1-(3-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-6-yl]pentoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 163985201 |
| Molecular Formula | C28H32ClN3O2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 7-[5-[1-(3-chlorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-6-yl]pentoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCCC3CCc4cnn(-c5cccc(Cl)c5)c4CC3)cc2N1 |
| InChI | InChI=1S/C28H32ClN3O2/c29-23-6-4-7-24(17-23)32-27-14-9-20(8-10-22(27)19-30-32)5-2-1-3-16-34-25-13-11-21-12-15-28(33)31-26(21)18-25/h4,6-7,11,13,17-20H,1-3,5,8-10,12,14-16H2,(H,31,33) |
| InChIKey | TVRJJYZBZGMVKC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|