About 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene
5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene (PubChem CID 163985735) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene |
| PubChem CID | 163985735 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene |
| SMILES | CC1C=CC=CC1CC1=CCCC=C1 |
| InChI | InChI=1S/C14H18/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13/h3,5-10,12,14H,2,4,11H2,1H3 |
| InChIKey | TWDIKPCAGVPCJC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene?
The IUPAC name of 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene (CID 163985735) is 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene.
What is the SMILES notation for 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene?
The canonical SMILES for 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene is CC1C=CC=CC1CC1=CCCC=C1.
What is the InChIKey of 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene?
The InChIKey is TWDIKPCAGVPCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13/h3,5-10,12,14H,2,4,11H2,1H3.
What are the key properties of 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene?
5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene has a molecular weight of 186.30 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexa-1,5-dien-1-ylmethyl)-6-methylcyclohexa-1,3-diene is sourced from PubChem (CID 163985735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).