About 5-methoxy-4,6-dimethyl-2,3-dihydropyridine
5-methoxy-4,6-dimethyl-2,3-dihydropyridine (PubChem CID 163985804) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-methoxy-4,6-dimethyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 5-methoxy-4,6-dimethyl-2,3-dihydropyridine |
| PubChem CID | 163985804 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 5-methoxy-4,6-dimethyl-2,3-dihydropyridine |
| SMILES | COC1=C(C)CCN=C1C |
| InChI | InChI=1S/C8H13NO/c1-6-4-5-9-7(2)8(6)10-3/h4-5H2,1-3H3 |
| InChIKey | TWEYHCODVRWMHN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-4,6-dimethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4,6-dimethyl-2,3-dihydropyridine?
The IUPAC name of 5-methoxy-4,6-dimethyl-2,3-dihydropyridine (CID 163985804) is 5-methoxy-4,6-dimethyl-2,3-dihydropyridine.
What is the SMILES notation for 5-methoxy-4,6-dimethyl-2,3-dihydropyridine?
The canonical SMILES for 5-methoxy-4,6-dimethyl-2,3-dihydropyridine is COC1=C(C)CCN=C1C.
What is the InChIKey of 5-methoxy-4,6-dimethyl-2,3-dihydropyridine?
The InChIKey is TWEYHCODVRWMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-6-4-5-9-7(2)8(6)10-3/h4-5H2,1-3H3.
What are the key properties of 5-methoxy-4,6-dimethyl-2,3-dihydropyridine?
5-methoxy-4,6-dimethyl-2,3-dihydropyridine has a molecular weight of 139.20 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4,6-dimethyl-2,3-dihydropyridine is sourced from PubChem (CID 163985804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).