C21H22FN7O — CID 163986154
N-(3-fluorophenyl)-6-(2-hydrazinylideneethanimidoyl)-7-piperidin-4-yloxyquinazolin-2-amine (PubChem CID 163986154) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-(2-hydrazinylideneethanimidoyl)-7-piperidin-4-yloxyquinazolin-2-amine.
| Compound Name | N-(3-fluorophenyl)-6-(2-hydrazinylideneethanimidoyl)-7-piperidin-4-yloxyquinazolin-2-amine |
|---|---|
| PubChem CID | 163986154 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-(3-fluorophenyl)-6-(2-hydrazinylideneethanimidoyl)-7-piperidin-4-yloxyquinazolin-2-amine |
| SMILES | [H]/N=C(\C=NN)c1cc2cnc(Nc3cccc(F)c3)nc2cc1OC1CCNCC1 |
| InChI | InChI=1S/C21H22FN7O/c22-14-2-1-3-15(9-14)28-21-26-11-13-8-17(18(23)12-27-24)20(10-19(13)29-21)30-16-4-6-25-7-5-16/h1-3,8-12,16,23,25H,4-7,24H2,(H,26,28,29)/b23-18+,27-12? |
| InChIKey | ZSTBESNCKMOHKE-XEBQJPRHSA-N |
| XLogP | 2.96 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|