C17H20F3OS+ — CID 163986705
1-[4-(2,2,2-trifluoroethoxy)-4a,8a-dihydronaphthalen-1-yl]thian-1-ium (PubChem CID 163986705) has the molecular formula C17H20F3OS+ and a molecular weight of 329.41 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethoxy)-4a,8a-dihydronaphthalen-1-yl]thian-1-ium.
| Compound Name | 1-[4-(2,2,2-trifluoroethoxy)-4a,8a-dihydronaphthalen-1-yl]thian-1-ium |
|---|---|
| PubChem CID | 163986705 |
| Molecular Formula | C17H20F3OS+ |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethoxy)-4a,8a-dihydronaphthalen-1-yl]thian-1-ium |
| SMILES | FC(F)(F)COC1=CC=C([S+]2CCCCC2)C2C=CC=CC12 |
| InChI | InChI=1S/C17H20F3OS/c18-17(19,20)12-21-15-8-9-16(22-10-4-1-5-11-22)14-7-3-2-6-13(14)15/h2-3,6-9,13-14H,1,4-5,10-12H2/q+1 |
| InChIKey | TWZBMGLGRHQOIS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|