C19H30NO6+ — CID 163987235
(2,5-dicarboxy-9-methoxy-4,4,7,7,8,8-hexamethyl-9-oxonon-1-en-5-yl)-methylidyneazanium (PubChem CID 163987235) has the molecular formula C19H30NO6+ and a molecular weight of 368.45 g/mol. Its IUPAC name is (2,5-dicarboxy-9-methoxy-4,4,7,7,8,8-hexamethyl-9-oxonon-1-en-5-yl)-methylidyneazanium.
| Compound Name | (2,5-dicarboxy-9-methoxy-4,4,7,7,8,8-hexamethyl-9-oxonon-1-en-5-yl)-methylidyneazanium |
|---|---|
| PubChem CID | 163987235 |
| Molecular Formula | C19H30NO6+ |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (2,5-dicarboxy-9-methoxy-4,4,7,7,8,8-hexamethyl-9-oxonon-1-en-5-yl)-methylidyneazanium |
| SMILES | C#[N+]C(CC(C)(C)C(C)(C)C(=O)OC)(C(=O)O)C(C)(C)CC(=C)C(=O)O |
| InChI | InChI=1S/C19H29NO6/c1-12(13(21)22)10-16(2,3)19(20-8,14(23)24)11-17(4,5)18(6,7)15(25)26-9/h8H,1,10-11H2,2-7,9H3,(H-,21,22,23,24)/p+1 |
| InChIKey | KEAAEKPQSZAVBT-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|