About 7-ethyl-N-methyl-1,3-benzothiazol-2-amine
7-ethyl-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 163988117) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 7-ethyl-N-methyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 7-ethyl-N-methyl-1,3-benzothiazol-2-amine |
| PubChem CID | 163988117 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 7-ethyl-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCc1cccc2nc(NC)sc12 |
| InChI | InChI=1S/C10H12N2S/c1-3-7-5-4-6-8-9(7)13-10(11-2)12-8/h4-6H,3H2,1-2H3,(H,11,12) |
| InChIKey | TYDRYANFTNIZPF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethyl-N-methyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-N-methyl-1,3-benzothiazol-2-amine?
The IUPAC name of 7-ethyl-N-methyl-1,3-benzothiazol-2-amine (CID 163988117) is 7-ethyl-N-methyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for 7-ethyl-N-methyl-1,3-benzothiazol-2-amine?
The canonical SMILES for 7-ethyl-N-methyl-1,3-benzothiazol-2-amine is CCc1cccc2nc(NC)sc12.
What is the InChIKey of 7-ethyl-N-methyl-1,3-benzothiazol-2-amine?
The InChIKey is TYDRYANFTNIZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-3-7-5-4-6-8-9(7)13-10(11-2)12-8/h4-6H,3H2,1-2H3,(H,11,12).
What are the key properties of 7-ethyl-N-methyl-1,3-benzothiazol-2-amine?
7-ethyl-N-methyl-1,3-benzothiazol-2-amine has a molecular weight of 192.29 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-N-methyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 163988117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).