C31H33NO2 — CID 163988255
4-[(2Z,4E,6Z)-7-(4-hydroxy-3,5-dimethylphenyl)-7-(methylideneamino)-5-(4-methylphenyl)hepta-2,4,6-trien-3-yl]-2,6-dimethylphenol (PubChem CID 163988255) has the molecular formula C31H33NO2 and a molecular weight of 451.61 g/mol. Its IUPAC name is 4-[(2Z,4E,6Z)-7-(4-hydroxy-3,5-dimethylphenyl)-7-(methylideneamino)-5-(4-methylphenyl)hepta-2,4,6-trien-3-yl]-2,6-dimethylphenol.
| Compound Name | 4-[(2Z,4E,6Z)-7-(4-hydroxy-3,5-dimethylphenyl)-7-(methylideneamino)-5-(4-methylphenyl)hepta-2,4,6-trien-3-yl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 163988255 |
| Molecular Formula | C31H33NO2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 4-[(2Z,4E,6Z)-7-(4-hydroxy-3,5-dimethylphenyl)-7-(methylideneamino)-5-(4-methylphenyl)hepta-2,4,6-trien-3-yl]-2,6-dimethylphenol |
| SMILES | C=N/C(=C\C(=C/C(=C/C)c1cc(C)c(O)c(C)c1)c1ccc(C)cc1)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C31H33NO2/c1-8-24(26-13-20(3)30(33)21(4)14-26)17-27(25-11-9-19(2)10-12-25)18-29(32-7)28-15-22(5)31(34)23(6)16-28/h8-18,33-34H,7H2,1-6H3/b24-8-,27-17+,29-18- |
| InChIKey | TYGVGNSCLQUJRU-GVCZZDSQSA-N |
| XLogP | 7.87 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|