C17H19F2N3O2S — CID 163988544
5-[(cyclopropyl-methylidene-oxo-λ6-sulfanyl)amino]-6-(2,4-difluoroanilino)-1,3-dimethylpyridin-2-one (PubChem CID 163988544) has the molecular formula C17H19F2N3O2S and a molecular weight of 367.42 g/mol. Its IUPAC name is 5-[(cyclopropyl-methylidene-oxo-λ6-sulfanyl)amino]-6-(2,4-difluoroanilino)-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[(cyclopropyl-methylidene-oxo-λ6-sulfanyl)amino]-6-(2,4-difluoroanilino)-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 163988544 |
| Molecular Formula | C17H19F2N3O2S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-[(cyclopropyl-methylidene-oxo-λ6-sulfanyl)amino]-6-(2,4-difluoroanilino)-1,3-dimethylpyridin-2-one |
| SMILES | C=S(=O)(Nc1cc(C)c(=O)n(C)c1Nc1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C17H19F2N3O2S/c1-10-8-15(21-25(3,24)12-5-6-12)16(22(2)17(10)23)20-14-7-4-11(18)9-13(14)19/h4,7-9,12,20H,3,5-6H2,1-2H3,(H,21,24) |
| InChIKey | TYNLRKJKNHHXSP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|