About N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine
N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine (PubChem CID 163989096) has the molecular formula C14H30N4+2
and a molecular weight of 254.42 g/mol. Its IUPAC name is N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine.
Molecular Properties
| Compound Name | N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine |
| PubChem CID | 163989096 |
| Molecular Formula | C14H30N4+2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine |
| SMILES | CC1CC1NCC[N+]12CC[N+](CCN)(CC1)CC2 |
| InChI | InChI=1S/C14H30N4/c1-13-12-14(13)16-3-5-18-9-6-17(4-2-15,7-10-18)8-11-18/h13-14,16H,2-12,15H2,1H3/q+2 |
| InChIKey | TYZMHPHLUQFYSE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine?
The IUPAC name of N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine (CID 163989096) is N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine.
What is the SMILES notation for N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine?
The canonical SMILES for N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine is CC1CC1NCC[N+]12CC[N+](CCN)(CC1)CC2.
What is the InChIKey of N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine?
The InChIKey is TYZMHPHLUQFYSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4/c1-13-12-14(13)16-3-5-18-9-6-17(4-2-15,7-10-18)8-11-18/h13-14,16H,2-12,15H2,1H3/q+2.
What are the key properties of N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine?
N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine has a molecular weight of 254.42 g/mol, XLogP of -0.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2-aminoethyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]ethyl]-2-methylcyclopropan-1-amine is sourced from PubChem (CID 163989096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).