C10H5BFN3O — CID 163989195
CID 163989195 (PubChem CID 163989195) has the molecular formula C10H5BFN3O and a molecular weight of 212.98 g/mol.
| Compound Name | CID 163989195 |
|---|---|
| PubChem CID | 163989195 |
| Molecular Formula | C10H5BFN3O |
| Molecular Weight | 212.98 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | — |
| SMILES | [B]c1ncoc1-c1c[nH]c2ncc(F)cc12 |
| InChI | InChI=1S/C10H5BFN3O/c11-9-8(16-4-15-9)7-3-14-10-6(7)1-5(12)2-13-10/h1-4H,(H,13,14) |
| InChIKey | RLJJPPJQIKRHNM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.98 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|