C20H20N5O5S+ — CID 163990204
2-(2-cyclopropylethyl)-5-hydroxy-6-thiophen-2-yl-4-(1,1,7-trihydroxy-4H-1,2,4-benzotriazin-1-ium-3-yl)pyridazin-3-one (PubChem CID 163990204) has the molecular formula C20H20N5O5S+ and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-(2-cyclopropylethyl)-5-hydroxy-6-thiophen-2-yl-4-(1,1,7-trihydroxy-4H-1,2,4-benzotriazin-1-ium-3-yl)pyridazin-3-one.
| Compound Name | 2-(2-cyclopropylethyl)-5-hydroxy-6-thiophen-2-yl-4-(1,1,7-trihydroxy-4H-1,2,4-benzotriazin-1-ium-3-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 163990204 |
| Molecular Formula | C20H20N5O5S+ |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-(2-cyclopropylethyl)-5-hydroxy-6-thiophen-2-yl-4-(1,1,7-trihydroxy-4H-1,2,4-benzotriazin-1-ium-3-yl)pyridazin-3-one |
| SMILES | O=c1c(C2=N[N+](O)(O)c3cc(O)ccc3N2)c(O)c(-c2cccs2)nn1CCC1CC1 |
| InChI | InChI=1S/C20H19N5O5S/c26-12-5-6-13-14(10-12)25(29,30)23-19(21-13)16-18(27)17(15-2-1-9-31-15)22-24(20(16)28)8-7-11-3-4-11/h1-2,5-6,9-11,29-30H,3-4,7-8H2,(H2-,21,22,23,26,27,28)/p+1 |
| InChIKey | AZGXGQDSUXZMAA-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|